C21H33N3O5S2 — CID 55556370
[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-(1-methylsulfonylpiperidin-3-yl)methanone (PubChem CID 55556370) has the molecular formula C21H33N3O5S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is [4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-(1-methylsulfonylpiperidin-3-yl)methanone.
| Compound Name | [4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-(1-methylsulfonylpiperidin-3-yl)methanone |
|---|---|
| PubChem CID | 55556370 |
| Molecular Formula | C21H33N3O5S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | [4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-(1-methylsulfonylpiperidin-3-yl)methanone |
| SMILES | CCC(C)c1ccc(S(=O)(=O)N2CCN(C(=O)C3CCCN(S(C)(=O)=O)C3)CC2)cc1 |
| InChI | InChI=1S/C21H33N3O5S2/c1-4-17(2)18-7-9-20(10-8-18)31(28,29)23-14-12-22(13-15-23)21(25)19-6-5-11-24(16-19)30(3,26)27/h7-10,17,19H,4-6,11-16H2,1-3H3 |
| InChIKey | STMZDPCZRLHVDB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |