C22H33N3O4S — CID 55648006
N-[2-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]cyclopentanecarboxamide (PubChem CID 55648006) has the molecular formula C22H33N3O4S and a molecular weight of 435.59 g/mol. Its IUPAC name is N-[2-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 55648006 |
| Molecular Formula | C22H33N3O4S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N-[2-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]cyclopentanecarboxamide |
| SMILES | CCC(C)c1ccc(S(=O)(=O)N2CCN(C(=O)CNC(=O)C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C22H33N3O4S/c1-3-17(2)18-8-10-20(11-9-18)30(28,29)25-14-12-24(13-15-25)21(26)16-23-22(27)19-6-4-5-7-19/h8-11,17,19H,3-7,12-16H2,1-2H3,(H,23,27) |
| InChIKey | RSEBTUPGWIXJFI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |