C19H28N2O6S — CID 9230162
[2-[4-[4-[(2R)-butan-2-yl]phenyl]sulfonylpiperazin-1-yl]-2-oxoethyl] 2-methoxyacetate (PubChem CID 9230162) has the molecular formula C19H28N2O6S and a molecular weight of 412.51 g/mol. Its IUPAC name is [2-[4-[4-[(2R)-butan-2-yl]phenyl]sulfonylpiperazin-1-yl]-2-oxoethyl] 2-methoxyacetate.
| Compound Name | [2-[4-[4-[(2R)-butan-2-yl]phenyl]sulfonylpiperazin-1-yl]-2-oxoethyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 9230162 |
| Molecular Formula | C19H28N2O6S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | [2-[4-[4-[(2R)-butan-2-yl]phenyl]sulfonylpiperazin-1-yl]-2-oxoethyl] 2-methoxyacetate |
| SMILES | CC[C@@H](C)c1ccc(S(=O)(=O)N2CCN(C(=O)COC(=O)COC)CC2)cc1 |
| InChI | InChI=1S/C19H28N2O6S/c1-4-15(2)16-5-7-17(8-6-16)28(24,25)21-11-9-20(10-12-21)18(22)13-27-19(23)14-26-3/h5-8,15H,4,9-14H2,1-3H3/t15-/m1/s1 |
| InChIKey | KLYSBUSVQFZBNP-OAHLLOKOSA-N |
| XLogP | 1.22 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |