C17H24ClN3O5S2 — CID 55555673
[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-(1-methylsulfonylpiperidin-3-yl)methanone (PubChem CID 55555673) has the molecular formula C17H24ClN3O5S2 and a molecular weight of 449.98 g/mol. Its IUPAC name is [4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-(1-methylsulfonylpiperidin-3-yl)methanone.
| Compound Name | [4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-(1-methylsulfonylpiperidin-3-yl)methanone |
|---|---|
| PubChem CID | 55555673 |
| Molecular Formula | C17H24ClN3O5S2 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | [4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-(1-methylsulfonylpiperidin-3-yl)methanone |
| SMILES | CS(=O)(=O)N1CCCC(C(=O)N2CCN(S(=O)(=O)c3cccc(Cl)c3)CC2)C1 |
| InChI | InChI=1S/C17H24ClN3O5S2/c1-27(23,24)21-7-3-4-14(13-21)17(22)19-8-10-20(11-9-19)28(25,26)16-6-2-5-15(18)12-16/h2,5-6,12,14H,3-4,7-11,13H2,1H3 |
| InChIKey | GYYABJRAPJLALL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |