C20H26ClN3O3S — CID 119678248
(3-aminocyclopentyl)-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 119678248) has the molecular formula C20H26ClN3O3S and a molecular weight of 423.97 g/mol. Its IUPAC name is (3-aminocyclopentyl)-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | (3-aminocyclopentyl)-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119678248 |
| Molecular Formula | C20H26ClN3O3S |
| Molecular Weight | 423.97 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (3-aminocyclopentyl)-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | Cl.NC1CCC(C(=O)N2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)C1 |
| InChI | InChI=1S/C20H25N3O3S.ClH/c21-18-7-5-17(13-18)20(24)22-9-11-23(12-10-22)27(25,26)19-8-6-15-3-1-2-4-16(15)14-19;/h1-4,6,8,14,17-18H,5,7,9-13,21H2;1H |
| InChIKey | YOKRWQWDUHAYMJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.97 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |