C14H17ClN2O2S — CID 119993487
(3S)-1-naphthalen-2-ylsulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 119993487) has the molecular formula C14H17ClN2O2S and a molecular weight of 312.82 g/mol. Its IUPAC name is (3S)-1-naphthalen-2-ylsulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | (3S)-1-naphthalen-2-ylsulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119993487 |
| Molecular Formula | C14H17ClN2O2S |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | (3S)-1-naphthalen-2-ylsulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.N[C@H]1CCN(S(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C14H16N2O2S.ClH/c15-13-7-8-16(10-13)19(17,18)14-6-5-11-3-1-2-4-12(11)9-14;/h1-6,9,13H,7-8,10,15H2;1H/t13-;/m0./s1 |
| InChIKey | AABBUTUDNKWUAS-ZOWNYOTGSA-N |
| XLogP | 1.98 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |