C13H15ClN2O4S — CID 119993407
6-[(3S)-3-aminopyrrolidin-1-yl]sulfonylchromen-2-one;hydrochloride (PubChem CID 119993407) has the molecular formula C13H15ClN2O4S and a molecular weight of 330.79 g/mol. Its IUPAC name is 6-[(3S)-3-aminopyrrolidin-1-yl]sulfonylchromen-2-one;hydrochloride.
| Compound Name | 6-[(3S)-3-aminopyrrolidin-1-yl]sulfonylchromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 119993407 |
| Molecular Formula | C13H15ClN2O4S |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 6-[(3S)-3-aminopyrrolidin-1-yl]sulfonylchromen-2-one;hydrochloride |
| SMILES | Cl.N[C@H]1CCN(S(=O)(=O)c2ccc3oc(=O)ccc3c2)C1 |
| InChI | InChI=1S/C13H14N2O4S.ClH/c14-10-5-6-15(8-10)20(17,18)11-2-3-12-9(7-11)1-4-13(16)19-12;/h1-4,7,10H,5-6,8,14H2;1H/t10-;/m0./s1 |
| InChIKey | QZLLAHRVVWZUKB-PPHPATTJSA-N |
| XLogP | 0.94 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|