C18H22N2O4S — CID 120714302
6-(4-pyrrolidin-2-ylpiperidin-1-yl)sulfonylchromen-2-one (PubChem CID 120714302) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 6-(4-pyrrolidin-2-ylpiperidin-1-yl)sulfonylchromen-2-one.
| Compound Name | 6-(4-pyrrolidin-2-ylpiperidin-1-yl)sulfonylchromen-2-one |
|---|---|
| PubChem CID | 120714302 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 6-(4-pyrrolidin-2-ylpiperidin-1-yl)sulfonylchromen-2-one |
| SMILES | O=c1ccc2cc(S(=O)(=O)N3CCC(C4CCCN4)CC3)ccc2o1 |
| InChI | InChI=1S/C18H22N2O4S/c21-18-6-3-14-12-15(4-5-17(14)24-18)25(22,23)20-10-7-13(8-11-20)16-2-1-9-19-16/h3-6,12-13,16,19H,1-2,7-11H2 |
| InChIKey | LWRKBSNGGWGHPG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|