C21H22N2O4S — CID 146075208
6-[4-(2,6-dimethylphenyl)piperazin-1-yl]sulfonylchromen-2-one (PubChem CID 146075208) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 6-[4-(2,6-dimethylphenyl)piperazin-1-yl]sulfonylchromen-2-one.
| Compound Name | 6-[4-(2,6-dimethylphenyl)piperazin-1-yl]sulfonylchromen-2-one |
|---|---|
| PubChem CID | 146075208 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 6-[4-(2,6-dimethylphenyl)piperazin-1-yl]sulfonylchromen-2-one |
| SMILES | Cc1cccc(C)c1N1CCN(S(=O)(=O)c2ccc3oc(=O)ccc3c2)CC1 |
| InChI | InChI=1S/C21H22N2O4S/c1-15-4-3-5-16(2)21(15)22-10-12-23(13-11-22)28(25,26)18-7-8-19-17(14-18)6-9-20(24)27-19/h3-9,14H,10-13H2,1-2H3 |
| InChIKey | TXKSJGICSCQMLH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|