C19H23BrN2O2S — CID 91670238
1-(4-bromo-3-methylphenyl)sulfonyl-4-(2,6-dimethylphenyl)piperazine (PubChem CID 91670238) has the molecular formula C19H23BrN2O2S and a molecular weight of 423.38 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)sulfonyl-4-(2,6-dimethylphenyl)piperazine.
| Compound Name | 1-(4-bromo-3-methylphenyl)sulfonyl-4-(2,6-dimethylphenyl)piperazine |
|---|---|
| PubChem CID | 91670238 |
| Molecular Formula | C19H23BrN2O2S |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)sulfonyl-4-(2,6-dimethylphenyl)piperazine |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(c3c(C)cccc3C)CC2)ccc1Br |
| InChI | InChI=1S/C19H23BrN2O2S/c1-14-5-4-6-15(2)19(14)21-9-11-22(12-10-21)25(23,24)17-7-8-18(20)16(3)13-17/h4-8,13H,9-12H2,1-3H3 |
| InChIKey | WFADRFJTSOKXEZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |