C19H23ClN2O2S — CID 19132655
1-(3-chlorophenyl)sulfonyl-4-(2,4,6-trimethylphenyl)piperazine (PubChem CID 19132655) has the molecular formula C19H23ClN2O2S and a molecular weight of 378.93 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-4-(2,4,6-trimethylphenyl)piperazine.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-4-(2,4,6-trimethylphenyl)piperazine |
|---|---|
| PubChem CID | 19132655 |
| Molecular Formula | C19H23ClN2O2S |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-4-(2,4,6-trimethylphenyl)piperazine |
| SMILES | Cc1cc(C)c(N2CCN(S(=O)(=O)c3cccc(Cl)c3)CC2)c(C)c1 |
| InChI | InChI=1S/C19H23ClN2O2S/c1-14-11-15(2)19(16(3)12-14)21-7-9-22(10-8-21)25(23,24)18-6-4-5-17(20)13-18/h4-6,11-13H,7-10H2,1-3H3 |
| InChIKey | GPOCPOMHODSFCV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |