C17H19Cl2N3O2S — CID 24852723
1-(3,5-dichloro-4-pyridinyl)-4-(3-methylphenyl)sulfonyl-1,4-diazepane (PubChem CID 24852723) has the molecular formula C17H19Cl2N3O2S and a molecular weight of 400.33 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-pyridinyl)-4-(3-methylphenyl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(3,5-dichloro-4-pyridinyl)-4-(3-methylphenyl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 24852723 |
| Molecular Formula | C17H19Cl2N3O2S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 1-(3,5-dichloro-4-pyridinyl)-4-(3-methylphenyl)sulfonyl-1,4-diazepane |
| SMILES | Cc1cccc(S(=O)(=O)N2CCCN(c3c(Cl)cncc3Cl)CC2)c1 |
| InChI | InChI=1S/C17H19Cl2N3O2S/c1-13-4-2-5-14(10-13)25(23,24)22-7-3-6-21(8-9-22)17-15(18)11-20-12-16(17)19/h2,4-5,10-12H,3,6-9H2,1H3 |
| InChIKey | HWCDTMHLEIDTFQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |