About 1-(benzenesulfonyl)-4-(4-methyl-2-pyridinyl)-1,4-diazepane
1-(benzenesulfonyl)-4-(4-methyl-2-pyridinyl)-1,4-diazepane (PubChem CID 136514751) has the molecular formula C17H21N3O2S
and a molecular weight of 331.44 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-(4-methyl-2-pyridinyl)-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-4-(4-methyl-2-pyridinyl)-1,4-diazepane |
| PubChem CID | 136514751 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-(benzenesulfonyl)-4-(4-methyl-2-pyridinyl)-1,4-diazepane |
| SMILES | Cc1ccnc(N2CCCN(S(=O)(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C17H21N3O2S/c1-15-8-9-18-17(14-15)19-10-5-11-20(13-12-19)23(21,22)16-6-3-2-4-7-16/h2-4,6-9,14H,5,10-13H2,1H3 |
| InChIKey | YRKBJDWUXZVZPS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(benzenesulfonyl)-4-(4-methyl-2-pyridinyl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-4-(4-methyl-2-pyridinyl)-1,4-diazepane?
The IUPAC name of 1-(benzenesulfonyl)-4-(4-methyl-2-pyridinyl)-1,4-diazepane (CID 136514751) is 1-(benzenesulfonyl)-4-(4-methyl-2-pyridinyl)-1,4-diazepane.
What is the SMILES notation for 1-(benzenesulfonyl)-4-(4-methyl-2-pyridinyl)-1,4-diazepane?
The canonical SMILES for 1-(benzenesulfonyl)-4-(4-methyl-2-pyridinyl)-1,4-diazepane is Cc1ccnc(N2CCCN(S(=O)(=O)c3ccccc3)CC2)c1.
What is the InChIKey of 1-(benzenesulfonyl)-4-(4-methyl-2-pyridinyl)-1,4-diazepane?
The InChIKey is YRKBJDWUXZVZPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O2S/c1-15-8-9-18-17(14-15)19-10-5-11-20(13-12-19)23(21,22)16-6-3-2-4-7-16/h2-4,6-9,14H,5,10-13H2,1H3.
What are the key properties of 1-(benzenesulfonyl)-4-(4-methyl-2-pyridinyl)-1,4-diazepane?
1-(benzenesulfonyl)-4-(4-methyl-2-pyridinyl)-1,4-diazepane has a molecular weight of 331.44 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-4-(4-methyl-2-pyridinyl)-1,4-diazepane is sourced from PubChem (CID 136514751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).