C23H26N4O3S — CID 46335140
6-[4-(3,5-dimethylphenyl)sulfonyl-1,4-diazepan-1-yl]-2-phenylpyridazin-3-one (PubChem CID 46335140) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 6-[4-(3,5-dimethylphenyl)sulfonyl-1,4-diazepan-1-yl]-2-phenylpyridazin-3-one.
| Compound Name | 6-[4-(3,5-dimethylphenyl)sulfonyl-1,4-diazepan-1-yl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 46335140 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 6-[4-(3,5-dimethylphenyl)sulfonyl-1,4-diazepan-1-yl]-2-phenylpyridazin-3-one |
| SMILES | Cc1cc(C)cc(S(=O)(=O)N2CCCN(c3ccc(=O)n(-c4ccccc4)n3)CC2)c1 |
| InChI | InChI=1S/C23H26N4O3S/c1-18-15-19(2)17-21(16-18)31(29,30)26-12-6-11-25(13-14-26)22-9-10-23(28)27(24-22)20-7-4-3-5-8-20/h3-5,7-10,15-17H,6,11-14H2,1-2H3 |
| InChIKey | WREYNVNEOHVLDB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |