C22H23ClN4O4S — CID 53081668
6-[4-(5-chloro-2-methoxyphenyl)sulfonylpiperazin-1-yl]-2-(4-methylphenyl)pyridazin-3-one (PubChem CID 53081668) has the molecular formula C22H23ClN4O4S and a molecular weight of 474.97 g/mol. Its IUPAC name is 6-[4-(5-chloro-2-methoxyphenyl)sulfonylpiperazin-1-yl]-2-(4-methylphenyl)pyridazin-3-one.
| Compound Name | 6-[4-(5-chloro-2-methoxyphenyl)sulfonylpiperazin-1-yl]-2-(4-methylphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 53081668 |
| Molecular Formula | C22H23ClN4O4S |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 6-[4-(5-chloro-2-methoxyphenyl)sulfonylpiperazin-1-yl]-2-(4-methylphenyl)pyridazin-3-one |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1CCN(c2ccc(=O)n(-c3ccc(C)cc3)n2)CC1 |
| InChI | InChI=1S/C22H23ClN4O4S/c1-16-3-6-18(7-4-16)27-22(28)10-9-21(24-27)25-11-13-26(14-12-25)32(29,30)20-15-17(23)5-8-19(20)31-2/h3-10,15H,11-14H2,1-2H3 |
| InChIKey | WLWVRQXVKXHXBL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |