C20H27N5O3S — CID 121053052
3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-yl]-6-pyrrolidin-1-ylpyridazine (PubChem CID 121053052) has the molecular formula C20H27N5O3S and a molecular weight of 417.54 g/mol. Its IUPAC name is 3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-yl]-6-pyrrolidin-1-ylpyridazine.
| Compound Name | 3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-yl]-6-pyrrolidin-1-ylpyridazine |
|---|---|
| PubChem CID | 121053052 |
| Molecular Formula | C20H27N5O3S |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 3-[4-(2-methoxy-5-methylphenyl)sulfonylpiperazin-1-yl]-6-pyrrolidin-1-ylpyridazine |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N1CCN(c2ccc(N3CCCC3)nn2)CC1 |
| InChI | InChI=1S/C20H27N5O3S/c1-16-5-6-17(28-2)18(15-16)29(26,27)25-13-11-24(12-14-25)20-8-7-19(21-22-20)23-9-3-4-10-23/h5-8,15H,3-4,9-14H2,1-2H3 |
| InChIKey | QXORFDNGWNAQGW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |