C21H29N5O3S — CID 122335122
1-[6-[4-(2-methoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-3-yl]azepane (PubChem CID 122335122) has the molecular formula C21H29N5O3S and a molecular weight of 431.56 g/mol. Its IUPAC name is 1-[6-[4-(2-methoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-3-yl]azepane.
| Compound Name | 1-[6-[4-(2-methoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-3-yl]azepane |
|---|---|
| PubChem CID | 122335122 |
| Molecular Formula | C21H29N5O3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 1-[6-[4-(2-methoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-3-yl]azepane |
| SMILES | COc1ccccc1S(=O)(=O)N1CCN(c2ccc(N3CCCCCC3)nn2)CC1 |
| InChI | InChI=1S/C21H29N5O3S/c1-29-18-8-4-5-9-19(18)30(27,28)26-16-14-25(15-17-26)21-11-10-20(22-23-21)24-12-6-2-3-7-13-24/h4-5,8-11H,2-3,6-7,12-17H2,1H3 |
| InChIKey | VMFLNDIFJVLLPK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |