C20H22N6O3S — CID 122347561
6-[4-(2-methoxyphenyl)sulfonylpiperazin-1-yl]-N-pyridin-2-ylpyridazin-3-amine (PubChem CID 122347561) has the molecular formula C20H22N6O3S and a molecular weight of 426.50 g/mol. Its IUPAC name is 6-[4-(2-methoxyphenyl)sulfonylpiperazin-1-yl]-N-pyridin-2-ylpyridazin-3-amine.
| Compound Name | 6-[4-(2-methoxyphenyl)sulfonylpiperazin-1-yl]-N-pyridin-2-ylpyridazin-3-amine |
|---|---|
| PubChem CID | 122347561 |
| Molecular Formula | C20H22N6O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 6-[4-(2-methoxyphenyl)sulfonylpiperazin-1-yl]-N-pyridin-2-ylpyridazin-3-amine |
| SMILES | COc1ccccc1S(=O)(=O)N1CCN(c2ccc(Nc3ccccn3)nn2)CC1 |
| InChI | InChI=1S/C20H22N6O3S/c1-29-16-6-2-3-7-17(16)30(27,28)26-14-12-25(13-15-26)20-10-9-19(23-24-20)22-18-8-4-5-11-21-18/h2-11H,12-15H2,1H3,(H,21,22,23) |
| InChIKey | WOXVMWUXYCMHLH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |