C19H25N5O4S — CID 122335405
4-[6-[4-(2-methoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-3-yl]morpholine (PubChem CID 122335405) has the molecular formula C19H25N5O4S and a molecular weight of 419.51 g/mol. Its IUPAC name is 4-[6-[4-(2-methoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-3-yl]morpholine.
| Compound Name | 4-[6-[4-(2-methoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-3-yl]morpholine |
|---|---|
| PubChem CID | 122335405 |
| Molecular Formula | C19H25N5O4S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 4-[6-[4-(2-methoxyphenyl)sulfonylpiperazin-1-yl]pyridazin-3-yl]morpholine |
| SMILES | COc1ccccc1S(=O)(=O)N1CCN(c2ccc(N3CCOCC3)nn2)CC1 |
| InChI | InChI=1S/C19H25N5O4S/c1-27-16-4-2-3-5-17(16)29(25,26)24-10-8-22(9-11-24)18-6-7-19(21-20-18)23-12-14-28-15-13-23/h2-7H,8-15H2,1H3 |
| InChIKey | QTNZMYJDWUVWGJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 88.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |