C20H24F3N5O3S — CID 122334805
3-piperidin-1-yl-6-[4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]pyridazine (PubChem CID 122334805) has the molecular formula C20H24F3N5O3S and a molecular weight of 471.51 g/mol. Its IUPAC name is 3-piperidin-1-yl-6-[4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]pyridazine.
| Compound Name | 3-piperidin-1-yl-6-[4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]pyridazine |
|---|---|
| PubChem CID | 122334805 |
| Molecular Formula | C20H24F3N5O3S |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 3-piperidin-1-yl-6-[4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]pyridazine |
| SMILES | O=S(=O)(c1ccccc1OC(F)(F)F)N1CCN(c2ccc(N3CCCCC3)nn2)CC1 |
| InChI | InChI=1S/C20H24F3N5O3S/c21-20(22,23)31-16-6-2-3-7-17(16)32(29,30)28-14-12-27(13-15-28)19-9-8-18(24-25-19)26-10-4-1-5-11-26/h2-3,6-9H,1,4-5,10-15H2 |
| InChIKey | JLUCMMRFIJUFHO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |