C20H21FN6O3S — CID 122347522
6-[4-(3-fluoro-4-methoxyphenyl)sulfonylpiperazin-1-yl]-N-pyridin-2-ylpyridazin-3-amine (PubChem CID 122347522) has the molecular formula C20H21FN6O3S and a molecular weight of 444.49 g/mol. Its IUPAC name is 6-[4-(3-fluoro-4-methoxyphenyl)sulfonylpiperazin-1-yl]-N-pyridin-2-ylpyridazin-3-amine.
| Compound Name | 6-[4-(3-fluoro-4-methoxyphenyl)sulfonylpiperazin-1-yl]-N-pyridin-2-ylpyridazin-3-amine |
|---|---|
| PubChem CID | 122347522 |
| Molecular Formula | C20H21FN6O3S |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 6-[4-(3-fluoro-4-methoxyphenyl)sulfonylpiperazin-1-yl]-N-pyridin-2-ylpyridazin-3-amine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3ccc(Nc4ccccn4)nn3)CC2)cc1F |
| InChI | InChI=1S/C20H21FN6O3S/c1-30-17-6-5-15(14-16(17)21)31(28,29)27-12-10-26(11-13-27)20-8-7-19(24-25-20)23-18-4-2-3-9-22-18/h2-9,14H,10-13H2,1H3,(H,22,23,24) |
| InChIKey | ZHKYHHQFZXPRTI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |