C19H19FN6O2S — CID 122349016
6-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-N-pyridin-2-ylpyrimidin-4-amine (PubChem CID 122349016) has the molecular formula C19H19FN6O2S and a molecular weight of 414.47 g/mol. Its IUPAC name is 6-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-N-pyridin-2-ylpyrimidin-4-amine.
| Compound Name | 6-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-N-pyridin-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 122349016 |
| Molecular Formula | C19H19FN6O2S |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 6-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-N-pyridin-2-ylpyrimidin-4-amine |
| SMILES | O=S(=O)(c1cccc(F)c1)N1CCN(c2cc(Nc3ccccn3)ncn2)CC1 |
| InChI | InChI=1S/C19H19FN6O2S/c20-15-4-3-5-16(12-15)29(27,28)26-10-8-25(9-11-26)19-13-18(22-14-23-19)24-17-6-1-2-7-21-17/h1-7,12-14H,8-11H2,(H,21,22,23,24) |
| InChIKey | CCKLKWGLPNCDFV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |