C20H21ClN6O2S — CID 122349853
6-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-2-methyl-N-pyridin-2-ylpyrimidin-4-amine (PubChem CID 122349853) has the molecular formula C20H21ClN6O2S and a molecular weight of 444.95 g/mol. Its IUPAC name is 6-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-2-methyl-N-pyridin-2-ylpyrimidin-4-amine.
| Compound Name | 6-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-2-methyl-N-pyridin-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 122349853 |
| Molecular Formula | C20H21ClN6O2S |
| Molecular Weight | 444.95 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 6-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-2-methyl-N-pyridin-2-ylpyrimidin-4-amine |
| SMILES | Cc1nc(Nc2ccccn2)cc(N2CCN(S(=O)(=O)c3cccc(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C20H21ClN6O2S/c1-15-23-19(25-18-7-2-3-8-22-18)14-20(24-15)26-9-11-27(12-10-26)30(28,29)17-6-4-5-16(21)13-17/h2-8,13-14H,9-12H2,1H3,(H,22,23,24,25) |
| InChIKey | UIBVXPJLYHVZIA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.95 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |