C24H25N7O4S — CID 122350100
1-[4-[4-[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione (PubChem CID 122350100) has the molecular formula C24H25N7O4S and a molecular weight of 507.58 g/mol. Its IUPAC name is 1-[4-[4-[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[4-[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 122350100 |
| Molecular Formula | C24H25N7O4S |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 1-[4-[4-[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione |
| SMILES | Cc1nc(Nc2ccccn2)cc(N2CCN(S(=O)(=O)c3ccc(N4C(=O)CCC4=O)cc3)CC2)n1 |
| InChI | InChI=1S/C24H25N7O4S/c1-17-26-21(28-20-4-2-3-11-25-20)16-22(27-17)29-12-14-30(15-13-29)36(34,35)19-7-5-18(6-8-19)31-23(32)9-10-24(31)33/h2-8,11,16H,9-10,12-15H2,1H3,(H,25,26,27,28) |
| InChIKey | CQSDLLHRDPPRBJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|