C17H19Cl2N3O3S — CID 24852724
1-(3,5-dichloro-4-pyridinyl)-4-(2-methoxyphenyl)sulfonyl-1,4-diazepane (PubChem CID 24852724) has the molecular formula C17H19Cl2N3O3S and a molecular weight of 416.33 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-pyridinyl)-4-(2-methoxyphenyl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(3,5-dichloro-4-pyridinyl)-4-(2-methoxyphenyl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 24852724 |
| Molecular Formula | C17H19Cl2N3O3S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 1-(3,5-dichloro-4-pyridinyl)-4-(2-methoxyphenyl)sulfonyl-1,4-diazepane |
| SMILES | COc1ccccc1S(=O)(=O)N1CCCN(c2c(Cl)cncc2Cl)CC1 |
| InChI | InChI=1S/C17H19Cl2N3O3S/c1-25-15-5-2-3-6-16(15)26(23,24)22-8-4-7-21(9-10-22)17-13(18)11-20-12-14(17)19/h2-3,5-6,11-12H,4,7-10H2,1H3 |
| InChIKey | JEFALSCNAVYKHQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |