About hydron;1-(2-methoxyphenyl)sulfonylpiperazine;chloride
hydron;1-(2-methoxyphenyl)sulfonylpiperazine;chloride (PubChem CID 51066589) has the molecular formula C11H17ClN2O3S
and a molecular weight of 292.79 g/mol. Its IUPAC name is hydron;1-(2-methoxyphenyl)sulfonylpiperazine;chloride.
Molecular Properties
| Compound Name | hydron;1-(2-methoxyphenyl)sulfonylpiperazine;chloride |
| PubChem CID | 51066589 |
| Molecular Formula | C11H17ClN2O3S |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | hydron;1-(2-methoxyphenyl)sulfonylpiperazine;chloride |
| SMILES | COc1ccccc1S(=O)(=O)N1CCNCC1.[Cl-].[H+] |
| InChI | InChI=1S/C11H16N2O3S.ClH/c1-16-10-4-2-3-5-11(10)17(14,15)13-8-6-12-7-9-13;/h2-5,12H,6-9H2,1H3;1H |
| InChIKey | FZEVDHUONZAWFS-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze hydron;1-(2-methoxyphenyl)sulfonylpiperazine;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;1-(2-methoxyphenyl)sulfonylpiperazine;chloride?
The IUPAC name of hydron;1-(2-methoxyphenyl)sulfonylpiperazine;chloride (CID 51066589) is hydron;1-(2-methoxyphenyl)sulfonylpiperazine;chloride.
What is the SMILES notation for hydron;1-(2-methoxyphenyl)sulfonylpiperazine;chloride?
The canonical SMILES for hydron;1-(2-methoxyphenyl)sulfonylpiperazine;chloride is COc1ccccc1S(=O)(=O)N1CCNCC1.[Cl-].[H+].
What is the InChIKey of hydron;1-(2-methoxyphenyl)sulfonylpiperazine;chloride?
The InChIKey is FZEVDHUONZAWFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3S.ClH/c1-16-10-4-2-3-5-11(10)17(14,15)13-8-6-12-7-9-13;/h2-5,12H,6-9H2,1H3;1H.
What are the key properties of hydron;1-(2-methoxyphenyl)sulfonylpiperazine;chloride?
hydron;1-(2-methoxyphenyl)sulfonylpiperazine;chloride has a molecular weight of 292.79 g/mol, XLogP of -2.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;1-(2-methoxyphenyl)sulfonylpiperazine;chloride is sourced from PubChem (CID 51066589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).