C14H22N2O5S2 — CID 110799657
1-ethylsulfonyl-4-(2-methoxyphenyl)sulfonyl-1,4-diazepane (PubChem CID 110799657) has the molecular formula C14H22N2O5S2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-ethylsulfonyl-4-(2-methoxyphenyl)sulfonyl-1,4-diazepane.
| Compound Name | 1-ethylsulfonyl-4-(2-methoxyphenyl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 110799657 |
| Molecular Formula | C14H22N2O5S2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1-ethylsulfonyl-4-(2-methoxyphenyl)sulfonyl-1,4-diazepane |
| SMILES | CCS(=O)(=O)N1CCCN(S(=O)(=O)c2ccccc2OC)CC1 |
| InChI | InChI=1S/C14H22N2O5S2/c1-3-22(17,18)15-9-6-10-16(12-11-15)23(19,20)14-8-5-4-7-13(14)21-2/h4-5,7-8H,3,6,9-12H2,1-2H3 |
| InChIKey | RUKKKGRLVOJGCQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |