C16H19N3O4S — CID 110805410
[4-(2-methoxyphenyl)sulfonylpiperazin-1-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 110805410) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is [4-(2-methoxyphenyl)sulfonylpiperazin-1-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [4-(2-methoxyphenyl)sulfonylpiperazin-1-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 110805410 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | [4-(2-methoxyphenyl)sulfonylpiperazin-1-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | COc1ccccc1S(=O)(=O)N1CCN(C(=O)c2ccc[nH]2)CC1 |
| InChI | InChI=1S/C16H19N3O4S/c1-23-14-6-2-3-7-15(14)24(21,22)19-11-9-18(10-12-19)16(20)13-5-4-8-17-13/h2-8,17H,9-12H2,1H3 |
| InChIKey | OPFWJJNXINUPBQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |