C9H14N4O3S — CID 61128995
4-(1H-pyrrole-2-carbonyl)piperazine-1-sulfonamide (PubChem CID 61128995) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is 4-(1H-pyrrole-2-carbonyl)piperazine-1-sulfonamide.
| Compound Name | 4-(1H-pyrrole-2-carbonyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 61128995 |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 4-(1H-pyrrole-2-carbonyl)piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(C(=O)c2ccc[nH]2)CC1 |
| InChI | InChI=1S/C9H14N4O3S/c10-17(15,16)13-6-4-12(5-7-13)9(14)8-2-1-3-11-8/h1-3,11H,4-7H2,(H2,10,15,16) |
| InChIKey | BYYMZZQDTYQWDN-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |