C14H17N3O3S2 — CID 110805245
[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 110805245) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is [4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 110805245 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | [4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc[nH]3)CC2)s1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-11-4-5-13(21-11)22(19,20)17-9-7-16(8-10-17)14(18)12-3-2-6-15-12/h2-6,15H,7-10H2,1H3 |
| InChIKey | VVMUNTGHILHYST-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |