C17H20N2O4S2 — CID 17476588
(3-methoxyphenyl)-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]methanone (PubChem CID 17476588) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is (3-methoxyphenyl)-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (3-methoxyphenyl)-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 17476588 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (3-methoxyphenyl)-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]methanone |
| SMILES | COc1cccc(C(=O)N2CCN(S(=O)(=O)c3ccc(C)s3)CC2)c1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-13-6-7-16(24-13)25(21,22)19-10-8-18(9-11-19)17(20)14-4-3-5-15(12-14)23-2/h3-7,12H,8-11H2,1-2H3 |
| InChIKey | QWXZSKJNRLJJPD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |