C21H26N2O6S — CID 30872670
[4-[4-(2-methoxyethoxy)phenyl]sulfonylpiperazin-1-yl]-(3-methoxyphenyl)methanone (PubChem CID 30872670) has the molecular formula C21H26N2O6S and a molecular weight of 434.51 g/mol. Its IUPAC name is [4-[4-(2-methoxyethoxy)phenyl]sulfonylpiperazin-1-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [4-[4-(2-methoxyethoxy)phenyl]sulfonylpiperazin-1-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 30872670 |
| Molecular Formula | C21H26N2O6S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | [4-[4-(2-methoxyethoxy)phenyl]sulfonylpiperazin-1-yl]-(3-methoxyphenyl)methanone |
| SMILES | COCCOc1ccc(S(=O)(=O)N2CCN(C(=O)c3cccc(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C21H26N2O6S/c1-27-14-15-29-18-6-8-20(9-7-18)30(25,26)23-12-10-22(11-13-23)21(24)17-4-3-5-19(16-17)28-2/h3-9,16H,10-15H2,1-2H3 |
| InChIKey | IOFJZXDWQDJQKE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|