C18H19IN2O4S — CID 2671434
(3-iodophenyl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 2671434) has the molecular formula C18H19IN2O4S and a molecular weight of 486.33 g/mol. Its IUPAC name is (3-iodophenyl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (3-iodophenyl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 2671434 |
| Molecular Formula | C18H19IN2O4S |
| Molecular Weight | 486.33 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | (3-iodophenyl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)c3cccc(I)c3)CC2)cc1 |
| InChI | InChI=1S/C18H19IN2O4S/c1-25-16-5-7-17(8-6-16)26(23,24)21-11-9-20(10-12-21)18(22)14-3-2-4-15(19)13-14/h2-8,13H,9-12H2,1H3 |
| InChIKey | IKIHFKMSMGANQX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|