C11H14IN3O3S — CID 61068450
4-(2-iodobenzoyl)piperazine-1-sulfonamide (PubChem CID 61068450) has the molecular formula C11H14IN3O3S and a molecular weight of 395.22 g/mol. Its IUPAC name is 4-(2-iodobenzoyl)piperazine-1-sulfonamide.
| Compound Name | 4-(2-iodobenzoyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 61068450 |
| Molecular Formula | C11H14IN3O3S |
| Molecular Weight | 395.22 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | 4-(2-iodobenzoyl)piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(C(=O)c2ccccc2I)CC1 |
| InChI | InChI=1S/C11H14IN3O3S/c12-10-4-2-1-3-9(10)11(16)14-5-7-15(8-6-14)19(13,17)18/h1-4H,5-8H2,(H2,13,17,18) |
| InChIKey | IMIKJCNQZWIZFS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.22 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|