C11H12INO3S — CID 61400654
(1,1-dioxo-1,4-thiazinan-4-yl)-(2-iodophenyl)methanone (PubChem CID 61400654) has the molecular formula C11H12INO3S and a molecular weight of 365.19 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-(2-iodophenyl)methanone.
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-(2-iodophenyl)methanone |
|---|---|
| PubChem CID | 61400654 |
| Molecular Formula | C11H12INO3S |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-(2-iodophenyl)methanone |
| SMILES | O=C(c1ccccc1I)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H12INO3S/c12-10-4-2-1-3-9(10)11(14)13-5-7-17(15,16)8-6-13/h1-4H,5-8H2 |
| InChIKey | WIHJYBVQJCFJMT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|