C17H12F5IN2O — CID 17116509
(2-iodophenyl)-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]methanone (PubChem CID 17116509) has the molecular formula C17H12F5IN2O and a molecular weight of 482.19 g/mol. Its IUPAC name is (2-iodophenyl)-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]methanone.
| Compound Name | (2-iodophenyl)-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 17116509 |
| Molecular Formula | C17H12F5IN2O |
| Molecular Weight | 482.19 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | (2-iodophenyl)-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccccc1I)N1CCN(c2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C17H12F5IN2O/c18-11-12(19)14(21)16(15(22)13(11)20)24-5-7-25(8-6-24)17(26)9-3-1-2-4-10(9)23/h1-4H,5-8H2 |
| InChIKey | IGVZYSITJSNTHC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.19 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|