C24H19F5N2O — CID 17110283
1-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]-2,2-diphenylethanone (PubChem CID 17110283) has the molecular formula C24H19F5N2O and a molecular weight of 446.42 g/mol. Its IUPAC name is 1-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 17110283 |
| Molecular Formula | C24H19F5N2O |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 1-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]-2,2-diphenylethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CCN(c2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C24H19F5N2O/c25-18-19(26)21(28)23(22(29)20(18)27)30-11-13-31(14-12-30)24(32)17(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17H,11-14H2 |
| InChIKey | PDSZRCAFFCLSHE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|