C26H25FN2O2 — CID 78849819
1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2,2-diphenylethanone (PubChem CID 78849819) has the molecular formula C26H25FN2O2 and a molecular weight of 416.50 g/mol. Its IUPAC name is 1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 78849819 |
| Molecular Formula | C26H25FN2O2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2,2-diphenylethanone |
| SMILES | O=C(c1ccccc1F)N1CCCN(C(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H25FN2O2/c27-23-15-8-7-14-22(23)25(30)28-16-9-17-29(19-18-28)26(31)24(20-10-3-1-4-11-20)21-12-5-2-6-13-21/h1-8,10-15,24H,9,16-19H2 |
| InChIKey | GIYDARRXWZYDET-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |