C33H32N2O2 — CID 5069183
1-[4-(2,2-diphenylacetyl)-1,4-diazepan-1-yl]-2,2-diphenylethanone (PubChem CID 5069183) has the molecular formula C33H32N2O2 and a molecular weight of 488.63 g/mol. Its IUPAC name is 1-[4-(2,2-diphenylacetyl)-1,4-diazepan-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[4-(2,2-diphenylacetyl)-1,4-diazepan-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 5069183 |
| Molecular Formula | C33H32N2O2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 1-[4-(2,2-diphenylacetyl)-1,4-diazepan-1-yl]-2,2-diphenylethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CCCN(C(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C33H32N2O2/c36-32(30(26-14-5-1-6-15-26)27-16-7-2-8-17-27)34-22-13-23-35(25-24-34)33(37)31(28-18-9-3-10-19-28)29-20-11-4-12-21-29/h1-12,14-21,30-31H,13,22-25H2 |
| InChIKey | FGUMVSKBVQBDPT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |