C20H24N2O — CID 2303179
1-(4-ethylpiperazin-1-yl)-2,2-diphenylethanone (PubChem CID 2303179) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-(4-ethylpiperazin-1-yl)-2,2-diphenylethanone.
| Compound Name | 1-(4-ethylpiperazin-1-yl)-2,2-diphenylethanone |
|---|---|
| PubChem CID | 2303179 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 1-(4-ethylpiperazin-1-yl)-2,2-diphenylethanone |
| SMILES | CCN1CCN(C(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N2O/c1-2-21-13-15-22(16-14-21)20(23)19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,19H,2,13-16H2,1H3 |
| InChIKey | XNNABTRMDHBRQZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |