C23H26N4O — CID 90508606
2,2-diphenyl-1-[4-(2-pyrazol-1-ylethyl)piperazin-1-yl]ethanone (PubChem CID 90508606) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is 2,2-diphenyl-1-[4-(2-pyrazol-1-ylethyl)piperazin-1-yl]ethanone.
| Compound Name | 2,2-diphenyl-1-[4-(2-pyrazol-1-ylethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 90508606 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 2,2-diphenyl-1-[4-(2-pyrazol-1-ylethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CCN(CCn2cccn2)CC1 |
| InChI | InChI=1S/C23H26N4O/c28-23(22(20-8-3-1-4-9-20)21-10-5-2-6-11-21)26-17-14-25(15-18-26)16-19-27-13-7-12-24-27/h1-13,22H,14-19H2 |
| InChIKey | JPRDENJUQWVJMQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |