C20H28N4O — CID 95985415
(2R)-2-phenyl-1-[4-(2-pyrazol-1-ylethyl)-1,4-diazepan-1-yl]butan-1-one (PubChem CID 95985415) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is (2R)-2-phenyl-1-[4-(2-pyrazol-1-ylethyl)-1,4-diazepan-1-yl]butan-1-one.
| Compound Name | (2R)-2-phenyl-1-[4-(2-pyrazol-1-ylethyl)-1,4-diazepan-1-yl]butan-1-one |
|---|---|
| PubChem CID | 95985415 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | (2R)-2-phenyl-1-[4-(2-pyrazol-1-ylethyl)-1,4-diazepan-1-yl]butan-1-one |
| SMILES | CC[C@@H](C(=O)N1CCCN(CCn2cccn2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H28N4O/c1-2-19(18-8-4-3-5-9-18)20(25)23-12-7-11-22(14-16-23)15-17-24-13-6-10-21-24/h3-6,8-10,13,19H,2,7,11-12,14-17H2,1H3/t19-/m1/s1 |
| InChIKey | LSLWXCROHMOCIX-LJQANCHMSA-N |
| XLogP | 2.61 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |