C17H27N3O — CID 43251729
1-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-2-phenylbutan-1-one (PubChem CID 43251729) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-2-phenylbutan-1-one.
| Compound Name | 1-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-2-phenylbutan-1-one |
|---|---|
| PubChem CID | 43251729 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 1-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-2-phenylbutan-1-one |
| SMILES | CCC(C(=O)N1CCCN(CCN)CC1)c1ccccc1 |
| InChI | InChI=1S/C17H27N3O/c1-2-16(15-7-4-3-5-8-15)17(21)20-11-6-10-19(12-9-18)13-14-20/h3-5,7-8,16H,2,6,9-14,18H2,1H3 |
| InChIKey | FCAJDVYAYYECAL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |