C14H22N4O — CID 43252398
4-(2-aminoethyl)-N-phenyl-1,4-diazepane-1-carboxamide (PubChem CID 43252398) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-phenyl-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(2-aminoethyl)-N-phenyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 43252398 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 4-(2-aminoethyl)-N-phenyl-1,4-diazepane-1-carboxamide |
| SMILES | NCCN1CCCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C14H22N4O/c15-7-10-17-8-4-9-18(12-11-17)14(19)16-13-5-2-1-3-6-13/h1-3,5-6H,4,7-12,15H2,(H,16,19) |
| InChIKey | GYSAOKRICBGFNX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |