C14H23N5O3S — CID 108875241
4-(2-aminoethyl)-N-[4-(methanesulfonamido)phenyl]piperazine-1-carboxamide (PubChem CID 108875241) has the molecular formula C14H23N5O3S and a molecular weight of 341.44 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-[4-(methanesulfonamido)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-aminoethyl)-N-[4-(methanesulfonamido)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108875241 |
| Molecular Formula | C14H23N5O3S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 4-(2-aminoethyl)-N-[4-(methanesulfonamido)phenyl]piperazine-1-carboxamide |
| SMILES | CS(=O)(=O)Nc1ccc(NC(=O)N2CCN(CCN)CC2)cc1 |
| InChI | InChI=1S/C14H23N5O3S/c1-23(21,22)17-13-4-2-12(3-5-13)16-14(20)19-10-8-18(7-6-15)9-11-19/h2-5,17H,6-11,15H2,1H3,(H,16,20) |
| InChIKey | HJTKPOCMOONMKJ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |