C25H28N4O4S — CID 67037713
4-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]-N-phenylpiperazine-1-carboxamide (PubChem CID 67037713) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is 4-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 67037713 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 4-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]-N-phenylpiperazine-1-carboxamide |
| SMILES | CS(=O)(=O)Nc1ccc(Oc2ccc(CN3CCN(C(=O)Nc4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C25H28N4O4S/c1-34(31,32)27-22-9-13-24(14-10-22)33-23-11-7-20(8-12-23)19-28-15-17-29(18-16-28)25(30)26-21-5-3-2-4-6-21/h2-14,27H,15-19H2,1H3,(H,26,30) |
| InChIKey | QUHNSHIGSNCVQP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |