C26H30N4O5S — CID 67038572
1-(4-hydroxyphenyl)-3-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]urea (PubChem CID 67038572) has the molecular formula C26H30N4O5S and a molecular weight of 510.62 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-3-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]urea.
| Compound Name | 1-(4-hydroxyphenyl)-3-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 67038572 |
| Molecular Formula | C26H30N4O5S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 1-(4-hydroxyphenyl)-3-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]urea |
| SMILES | CS(=O)(=O)Nc1ccc(Oc2ccc(CN3CCC(NC(=O)Nc4ccc(O)cc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H30N4O5S/c1-36(33,34)29-22-6-12-25(13-7-22)35-24-10-2-19(3-11-24)18-30-16-14-21(15-17-30)28-26(32)27-20-4-8-23(31)9-5-20/h2-13,21,29,31H,14-18H2,1H3,(H2,27,28,32) |
| InChIKey | OVSRAMHITSDTFH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|