C26H36N4O4S — CID 67037946
1-cyclohexyl-3-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]urea (PubChem CID 67037946) has the molecular formula C26H36N4O4S and a molecular weight of 500.67 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]urea.
| Compound Name | 1-cyclohexyl-3-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 67037946 |
| Molecular Formula | C26H36N4O4S |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 1-cyclohexyl-3-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]urea |
| SMILES | CS(=O)(=O)Nc1ccc(Oc2ccc(CN3CCC(NC(=O)NC4CCCCC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H36N4O4S/c1-35(32,33)29-23-9-13-25(14-10-23)34-24-11-7-20(8-12-24)19-30-17-15-22(16-18-30)28-26(31)27-21-5-3-2-4-6-21/h7-14,21-22,29H,2-6,15-19H2,1H3,(H2,27,28,31) |
| InChIKey | MENDPZDKKRXXIM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |