C27H33ClN4O5S — CID 87244873
1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]-3-phenylmethoxyurea;hydrochloride (PubChem CID 87244873) has the molecular formula C27H33ClN4O5S and a molecular weight of 561.10 g/mol. Its IUPAC name is 1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]-3-phenylmethoxyurea;hydrochloride.
| Compound Name | 1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]-3-phenylmethoxyurea;hydrochloride |
|---|---|
| PubChem CID | 87244873 |
| Molecular Formula | C27H33ClN4O5S |
| Molecular Weight | 561.10 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | 1-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]-3-phenylmethoxyurea;hydrochloride |
| SMILES | CS(=O)(=O)Nc1ccc(Oc2ccc(CN3CCC(NC(=O)NOCc4ccccc4)CC3)cc2)cc1.Cl |
| InChI | InChI=1S/C27H32N4O5S.ClH/c1-37(33,34)30-24-9-13-26(14-10-24)36-25-11-7-21(8-12-25)19-31-17-15-23(16-18-31)28-27(32)29-35-20-22-5-3-2-4-6-22;/h2-14,23,30H,15-20H2,1H3,(H2,28,29,32);1H |
| InChIKey | DJDIJTBAJCQKOF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.10 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|