C32H42N4O4S — CID 142677027
1-benzyl-3-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]-1-pentylurea (PubChem CID 142677027) has the molecular formula C32H42N4O4S and a molecular weight of 578.78 g/mol. Its IUPAC name is 1-benzyl-3-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]-1-pentylurea.
| Compound Name | 1-benzyl-3-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]-1-pentylurea |
|---|---|
| PubChem CID | 142677027 |
| Molecular Formula | C32H42N4O4S |
| Molecular Weight | 578.78 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | 1-benzyl-3-[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]-1-pentylurea |
| SMILES | CCCCCN(Cc1ccccc1)C(=O)NC1CCN(Cc2ccc(Oc3ccc(NS(C)(=O)=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C32H42N4O4S/c1-3-4-8-21-36(25-26-9-6-5-7-10-26)32(37)33-28-19-22-35(23-20-28)24-27-11-15-30(16-12-27)40-31-17-13-29(14-18-31)34-41(2,38)39/h5-7,9-18,28,34H,3-4,8,19-25H2,1-2H3,(H,33,37) |
| InChIKey | MYAJVBFCSCLOCQ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.78 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|